C14H12FNO2S — CID 63402216
1-(3,4-dimethylphenyl)sulfanyl-3-fluoro-2-nitrobenzene (PubChem CID 63402216) has the molecular formula C14H12FNO2S and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfanyl-3-fluoro-2-nitrobenzene.
| Compound Name | 1-(3,4-dimethylphenyl)sulfanyl-3-fluoro-2-nitrobenzene |
|---|---|
| PubChem CID | 63402216 |
| Molecular Formula | C14H12FNO2S |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfanyl-3-fluoro-2-nitrobenzene |
| SMILES | Cc1ccc(Sc2cccc(F)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C14H12FNO2S/c1-9-6-7-11(8-10(9)2)19-13-5-3-4-12(15)14(13)16(17)18/h3-8H,1-2H3 |
| InChIKey | UUFSUJHAFDTJQZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|