C15H20BrFO2 — CID 63402487
2-[(5-bromo-2-fluorophenyl)methyl]-2-ethylhexanoic acid (PubChem CID 63402487) has the molecular formula C15H20BrFO2 and a molecular weight of 331.22 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl]-2-ethylhexanoic acid.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl]-2-ethylhexanoic acid |
|---|---|
| PubChem CID | 63402487 |
| Molecular Formula | C15H20BrFO2 |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl]-2-ethylhexanoic acid |
| SMILES | CCCCC(CC)(Cc1cc(Br)ccc1F)C(=O)O |
| InChI | InChI=1S/C15H20BrFO2/c1-3-5-8-15(4-2,14(18)19)10-11-9-12(16)6-7-13(11)17/h6-7,9H,3-5,8,10H2,1-2H3,(H,18,19) |
| InChIKey | MBGDEVJHJUWCTH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |