C17H22F12O2 — CID 634056
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 3,7-dimethyloctanoate (PubChem CID 634056) has the molecular formula C17H22F12O2 and a molecular weight of 486.34 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 3,7-dimethyloctanoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 3,7-dimethyloctanoate |
|---|---|
| PubChem CID | 634056 |
| Molecular Formula | C17H22F12O2 |
| Molecular Weight | 486.34 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 3,7-dimethyloctanoate |
| SMILES | CC(C)CCCC(C)CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C17H22F12O2/c1-9(2)5-4-6-10(3)7-11(30)31-8-13(20,21)15(24,25)17(28,29)16(26,27)14(22,23)12(18)19/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | ZTAANFDORGHFPK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.34 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|