C14H14I3NO3 — CID 63405879
3-ethyl-1-(2,3,5-triiodobenzoyl)pyrrolidine-3-carboxylic acid (PubChem CID 63405879) has the molecular formula C14H14I3NO3 and a molecular weight of 624.98 g/mol. Its IUPAC name is 3-ethyl-1-(2,3,5-triiodobenzoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-ethyl-1-(2,3,5-triiodobenzoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63405879 |
| Molecular Formula | C14H14I3NO3 |
| Molecular Weight | 624.98 g/mol |
| Exact Mass | 624.81 |
| IUPAC Name | 3-ethyl-1-(2,3,5-triiodobenzoyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCN(C(=O)c2cc(I)cc(I)c2I)C1 |
| InChI | InChI=1S/C14H14I3NO3/c1-2-14(13(20)21)3-4-18(7-14)12(19)9-5-8(15)6-10(16)11(9)17/h5-6H,2-4,7H2,1H3,(H,20,21) |
| InChIKey | ITMNSGZIOAOPSH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.98 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|