About 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline
3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline (PubChem CID 63405914) has the molecular formula C17H19ClN2
and a molecular weight of 286.81 g/mol. Its IUPAC name is 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline.
Molecular Properties
| Compound Name | 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline |
| PubChem CID | 63405914 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline |
| SMILES | CC1CCc2ccccc2N1Cc1ccc(N)cc1Cl |
| InChI | InChI=1S/C17H19ClN2/c1-12-6-7-13-4-2-3-5-17(13)20(12)11-14-8-9-15(19)10-16(14)18/h2-5,8-10,12H,6-7,11,19H2,1H3 |
| InChIKey | UVGNVILPTLUZGX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline?
The IUPAC name of 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline (CID 63405914) is 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline.
What is the SMILES notation for 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline?
The canonical SMILES for 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline is CC1CCc2ccccc2N1Cc1ccc(N)cc1Cl.
What is the InChIKey of 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline?
The InChIKey is UVGNVILPTLUZGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN2/c1-12-6-7-13-4-2-3-5-17(13)20(12)11-14-8-9-15(19)10-16(14)18/h2-5,8-10,12H,6-7,11,19H2,1H3.
What are the key properties of 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline?
3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline has a molecular weight of 286.81 g/mol, XLogP of 4.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[(2-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]aniline is sourced from PubChem (CID 63405914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).