About 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde (PubChem CID 63407453) has the molecular formula C6H9N3OS
and a molecular weight of 171.22 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde |
| PubChem CID | 63407453 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde |
| SMILES | Cc1nnc(SCC=O)n1C |
| InChI | InChI=1S/C6H9N3OS/c1-5-7-8-6(9(5)2)11-4-3-10/h3H,4H2,1-2H3 |
| InChIKey | MIZCGOHSYJRNQO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde?
The IUPAC name of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde (CID 63407453) is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde.
What is the SMILES notation for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde?
The canonical SMILES for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde is Cc1nnc(SCC=O)n1C.
What is the InChIKey of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde?
The InChIKey is MIZCGOHSYJRNQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS/c1-5-7-8-6(9(5)2)11-4-3-10/h3H,4H2,1-2H3.
What are the key properties of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde?
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde has a molecular weight of 171.22 g/mol, XLogP of 0.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetaldehyde is sourced from PubChem (CID 63407453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).