About [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea
[(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea (PubChem CID 6340889) has the molecular formula C15H17N5S2
and a molecular weight of 331.47 g/mol. Its IUPAC name is [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea.
Molecular Properties
| Compound Name | [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea |
| PubChem CID | 6340889 |
| Molecular Formula | C15H17N5S2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea |
| SMILES | Cc1cc(C)nc(SC/C(=N/NC(N)=S)c2ccccc2)n1 |
| InChI | InChI=1S/C15H17N5S2/c1-10-8-11(2)18-15(17-10)22-9-13(19-20-14(16)21)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H3,16,20,21)/b19-13- |
| InChIKey | ABXLETMRMBMFNJ-UYRXBGFRSA-N |
| XLogP | 2.42 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea?
The IUPAC name of [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea (CID 6340889) is [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea.
What is the SMILES notation for [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea?
The canonical SMILES for [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea is Cc1cc(C)nc(SC/C(=N/NC(N)=S)c2ccccc2)n1.
What is the InChIKey of [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea?
The InChIKey is ABXLETMRMBMFNJ-UYRXBGFRSA-N. The full InChI is InChI=1S/C15H17N5S2/c1-10-8-11(2)18-15(17-10)22-9-13(19-20-14(16)21)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H3,16,20,21)/b19-13-.
What are the key properties of [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea?
[(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea has a molecular weight of 331.47 g/mol, XLogP of 2.42, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]thiourea is sourced from PubChem (CID 6340889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).