About 1-adamantyl-(3,5-dimethylphenyl)methanone
1-adamantyl-(3,5-dimethylphenyl)methanone (PubChem CID 63409870) has the molecular formula C19H24O
and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-adamantyl-(3,5-dimethylphenyl)methanone.
Molecular Properties
| Compound Name | 1-adamantyl-(3,5-dimethylphenyl)methanone |
| PubChem CID | 63409870 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-adamantyl-(3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C)cc(C(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H24O/c1-12-3-13(2)5-17(4-12)18(20)19-9-14-6-15(10-19)8-16(7-14)11-19/h3-5,14-16H,6-11H2,1-2H3 |
| InChIKey | DYRLFOKNSXTWMC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-adamantyl-(3,5-dimethylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl-(3,5-dimethylphenyl)methanone?
The IUPAC name of 1-adamantyl-(3,5-dimethylphenyl)methanone (CID 63409870) is 1-adamantyl-(3,5-dimethylphenyl)methanone.
What is the SMILES notation for 1-adamantyl-(3,5-dimethylphenyl)methanone?
The canonical SMILES for 1-adamantyl-(3,5-dimethylphenyl)methanone is Cc1cc(C)cc(C(=O)C23CC4CC(CC(C4)C2)C3)c1.
What is the InChIKey of 1-adamantyl-(3,5-dimethylphenyl)methanone?
The InChIKey is DYRLFOKNSXTWMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O/c1-12-3-13(2)5-17(4-12)18(20)19-9-14-6-15(10-19)8-16(7-14)11-19/h3-5,14-16H,6-11H2,1-2H3.
What are the key properties of 1-adamantyl-(3,5-dimethylphenyl)methanone?
1-adamantyl-(3,5-dimethylphenyl)methanone has a molecular weight of 268.40 g/mol, XLogP of 4.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl-(3,5-dimethylphenyl)methanone is sourced from PubChem (CID 63409870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).