C17H29NS — CID 63413397
N-[1-cyclohexyl-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine (PubChem CID 63413397) has the molecular formula C17H29NS and a molecular weight of 279.49 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-cyclohexyl-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63413397 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-[1-cyclohexyl-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(CC)s1)C1CCCCC1 |
| InChI | InChI=1S/C17H29NS/c1-3-12-18-17(14-8-6-5-7-9-14)13-16-11-10-15(4-2)19-16/h10-11,14,17-18H,3-9,12-13H2,1-2H3 |
| InChIKey | NGUHTTGITVADAJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |