C18H21BrOS — CID 63414703
2-(5-bromothiophen-2-yl)-1-(1-phenylcyclohexyl)ethanol (PubChem CID 63414703) has the molecular formula C18H21BrOS and a molecular weight of 365.34 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-1-(1-phenylcyclohexyl)ethanol.
| Compound Name | 2-(5-bromothiophen-2-yl)-1-(1-phenylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 63414703 |
| Molecular Formula | C18H21BrOS |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-1-(1-phenylcyclohexyl)ethanol |
| SMILES | OC(Cc1ccc(Br)s1)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H21BrOS/c19-17-10-9-15(21-17)13-16(20)18(11-5-2-6-12-18)14-7-3-1-4-8-14/h1,3-4,7-10,16,20H,2,5-6,11-13H2 |
| InChIKey | OCIKKIZQLOKQGC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |