C18H27BrFN — CID 63415531
N-[2-(3-bromo-4-fluorophenyl)-1-(4-methylcyclohexyl)ethyl]propan-1-amine (PubChem CID 63415531) has the molecular formula C18H27BrFN and a molecular weight of 356.32 g/mol. Its IUPAC name is N-[2-(3-bromo-4-fluorophenyl)-1-(4-methylcyclohexyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3-bromo-4-fluorophenyl)-1-(4-methylcyclohexyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63415531 |
| Molecular Formula | C18H27BrFN |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[2-(3-bromo-4-fluorophenyl)-1-(4-methylcyclohexyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(F)c(Br)c1)C1CCC(C)CC1 |
| InChI | InChI=1S/C18H27BrFN/c1-3-10-21-18(15-7-4-13(2)5-8-15)12-14-6-9-17(20)16(19)11-14/h6,9,11,13,15,18,21H,3-5,7-8,10,12H2,1-2H3 |
| InChIKey | QHNVKQMQVZOVGL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |