C14H21Cl2N — CID 63415710
1-(3,4-dichlorophenyl)-N,4-dimethylhexan-2-amine (PubChem CID 63415710) has the molecular formula C14H21Cl2N and a molecular weight of 274.23 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N,4-dimethylhexan-2-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-N,4-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 63415710 |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N,4-dimethylhexan-2-amine |
| SMILES | CCC(C)CC(Cc1ccc(Cl)c(Cl)c1)NC |
| InChI | InChI=1S/C14H21Cl2N/c1-4-10(2)7-12(17-3)8-11-5-6-13(15)14(16)9-11/h5-6,9-10,12,17H,4,7-8H2,1-3H3 |
| InChIKey | UCXNUOBLEIRAOQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |