C18H18BrNS — CID 63416626
2-(3-bromothiophen-2-yl)-N-ethyl-1-naphthalen-2-ylethanamine (PubChem CID 63416626) has the molecular formula C18H18BrNS and a molecular weight of 360.32 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-N-ethyl-1-naphthalen-2-ylethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-N-ethyl-1-naphthalen-2-ylethanamine |
|---|---|
| PubChem CID | 63416626 |
| Molecular Formula | C18H18BrNS |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-N-ethyl-1-naphthalen-2-ylethanamine |
| SMILES | CCNC(Cc1sccc1Br)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H18BrNS/c1-2-20-17(12-18-16(19)9-10-21-18)15-8-7-13-5-3-4-6-14(13)11-15/h3-11,17,20H,2,12H2,1H3 |
| InChIKey | QZYDYXVYACVYJT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |