C17H25ClFN — CID 63420165
1-(2-chloro-4-fluorophenyl)-3-cyclohexyl-N-ethylpropan-2-amine (PubChem CID 63420165) has the molecular formula C17H25ClFN and a molecular weight of 297.84 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-3-cyclohexyl-N-ethylpropan-2-amine.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-3-cyclohexyl-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 63420165 |
| Molecular Formula | C17H25ClFN |
| Molecular Weight | 297.84 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-3-cyclohexyl-N-ethylpropan-2-amine |
| SMILES | CCNC(Cc1ccc(F)cc1Cl)CC1CCCCC1 |
| InChI | InChI=1S/C17H25ClFN/c1-2-20-16(10-13-6-4-3-5-7-13)11-14-8-9-15(19)12-17(14)18/h8-9,12-13,16,20H,2-7,10-11H2,1H3 |
| InChIKey | WNPJWKIZPUROFN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.84 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |