C15H24BrNO2S — CID 63420895
5-bromo-2-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide (PubChem CID 63420895) has the molecular formula C15H24BrNO2S and a molecular weight of 362.33 g/mol. Its IUPAC name is 5-bromo-2-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63420895 |
| Molecular Formula | C15H24BrNO2S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 5-bromo-2-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C15H24BrNO2S/c1-11(2)9-17(10-12(3)4)20(18,19)15-8-14(16)7-6-13(15)5/h6-8,11-12H,9-10H2,1-5H3 |
| InChIKey | SWGIWOPVVFSQSG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |