C11H12FN5OS — CID 63424311
2-amino-5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-4-fluorobenzamide (PubChem CID 63424311) has the molecular formula C11H12FN5OS and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-amino-5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-4-fluorobenzamide.
| Compound Name | 2-amino-5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 63424311 |
| Molecular Formula | C11H12FN5OS |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-amino-5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-4-fluorobenzamide |
| SMILES | Cc1nnc(Sc2cc(C(N)=O)c(N)cc2F)n1C |
| InChI | InChI=1S/C11H12FN5OS/c1-5-15-16-11(17(5)2)19-9-3-6(10(14)18)8(13)4-7(9)12/h3-4H,13H2,1-2H3,(H2,14,18) |
| InChIKey | GMZFLFLNJGQLFN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|