C11H14Cl3N — CID 63425253
2,4,6-trichloro-N-(2,2-dimethylpropyl)aniline (PubChem CID 63425253) has the molecular formula C11H14Cl3N and a molecular weight of 266.60 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(2,2-dimethylpropyl)aniline.
| Compound Name | 2,4,6-trichloro-N-(2,2-dimethylpropyl)aniline |
|---|---|
| PubChem CID | 63425253 |
| Molecular Formula | C11H14Cl3N |
| Molecular Weight | 266.60 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2,4,6-trichloro-N-(2,2-dimethylpropyl)aniline |
| SMILES | CC(C)(C)CNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3N/c1-11(2,3)6-15-10-8(13)4-7(12)5-9(10)14/h4-5,15H,6H2,1-3H3 |
| InChIKey | YPHFOJSECWLCDG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |