C11H6Br2Cl3NO — CID 63425788
2,4,6-trichloro-N-[(4,5-dibromofuran-2-yl)methyl]aniline (PubChem CID 63425788) has the molecular formula C11H6Br2Cl3NO and a molecular weight of 434.34 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(4,5-dibromofuran-2-yl)methyl]aniline.
| Compound Name | 2,4,6-trichloro-N-[(4,5-dibromofuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 63425788 |
| Molecular Formula | C11H6Br2Cl3NO |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 430.79 |
| IUPAC Name | 2,4,6-trichloro-N-[(4,5-dibromofuran-2-yl)methyl]aniline |
| SMILES | Clc1cc(Cl)c(NCc2cc(Br)c(Br)o2)c(Cl)c1 |
| InChI | InChI=1S/C11H6Br2Cl3NO/c12-7-3-6(18-11(7)13)4-17-10-8(15)1-5(14)2-9(10)16/h1-3,17H,4H2 |
| InChIKey | HUMQUCDFUJGNNV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |