C17H18BrFO — CID 63426192
(4-bromo-3-fluorophenyl)-(2,3,5,6-tetramethylphenyl)methanol (PubChem CID 63426192) has the molecular formula C17H18BrFO and a molecular weight of 337.23 g/mol. Its IUPAC name is (4-bromo-3-fluorophenyl)-(2,3,5,6-tetramethylphenyl)methanol.
| Compound Name | (4-bromo-3-fluorophenyl)-(2,3,5,6-tetramethylphenyl)methanol |
|---|---|
| PubChem CID | 63426192 |
| Molecular Formula | C17H18BrFO |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (4-bromo-3-fluorophenyl)-(2,3,5,6-tetramethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C)c(C(O)c2ccc(Br)c(F)c2)c1C |
| InChI | InChI=1S/C17H18BrFO/c1-9-7-10(2)12(4)16(11(9)3)17(20)13-5-6-14(18)15(19)8-13/h5-8,17,20H,1-4H3 |
| InChIKey | RHSMCETYQPHLHZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |