About 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol
3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol (PubChem CID 63426516) has the molecular formula C12H16Cl2OS
and a molecular weight of 279.23 g/mol. Its IUPAC name is 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol |
| PubChem CID | 63426516 |
| Molecular Formula | C12H16Cl2OS |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol |
| SMILES | OC(CCC1CCCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H16Cl2OS/c13-11-7-9(12(14)16-11)10(15)6-5-8-3-1-2-4-8/h7-8,10,15H,1-6H2 |
| InChIKey | WJGPIUMTZAWZBC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol?
The IUPAC name of 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol (CID 63426516) is 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol.
What is the SMILES notation for 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol?
The canonical SMILES for 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol is OC(CCC1CCCC1)c1cc(Cl)sc1Cl.
What is the InChIKey of 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol?
The InChIKey is WJGPIUMTZAWZBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Cl2OS/c13-11-7-9(12(14)16-11)10(15)6-5-8-3-1-2-4-8/h7-8,10,15H,1-6H2.
What are the key properties of 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol?
3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol has a molecular weight of 279.23 g/mol, XLogP of 5.06, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1-(2,5-dichlorothiophen-3-yl)propan-1-ol is sourced from PubChem (CID 63426516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).