About 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol
3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol (PubChem CID 63427096) has the molecular formula C15H24OS
and a molecular weight of 252.42 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol |
| PubChem CID | 63427096 |
| Molecular Formula | C15H24OS |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol |
| SMILES | Cc1cc(C(O)CCC2CCCCC2)c(C)s1 |
| InChI | InChI=1S/C15H24OS/c1-11-10-14(12(2)17-11)15(16)9-8-13-6-4-3-5-7-13/h10,13,15-16H,3-9H2,1-2H3 |
| InChIKey | WWYZHMHMVXAFES-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol?
The IUPAC name of 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol (CID 63427096) is 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol.
What is the SMILES notation for 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol?
The canonical SMILES for 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol is Cc1cc(C(O)CCC2CCCCC2)c(C)s1.
What is the InChIKey of 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol?
The InChIKey is WWYZHMHMVXAFES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24OS/c1-11-10-14(12(2)17-11)15(16)9-8-13-6-4-3-5-7-13/h10,13,15-16H,3-9H2,1-2H3.
What are the key properties of 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol?
3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol has a molecular weight of 252.42 g/mol, XLogP of 4.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1-(2,5-dimethylthiophen-3-yl)propan-1-ol is sourced from PubChem (CID 63427096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).