C18H27NO — CID 63427518
4-methyl-2-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]phenol (PubChem CID 63427518) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 4-methyl-2-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]phenol.
| Compound Name | 4-methyl-2-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 63427518 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 4-methyl-2-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]phenol |
| SMILES | Cc1ccc(O)c(CNC2CC3CCC2(C)C3(C)C)c1 |
| InChI | InChI=1S/C18H27NO/c1-12-5-6-15(20)13(9-12)11-19-16-10-14-7-8-18(16,4)17(14,2)3/h5-6,9,14,16,19-20H,7-8,10-11H2,1-4H3 |
| InChIKey | QCDUYDREQXZKSI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|