C15H13BrCl2O2 — CID 63429005
4-bromo-1-chloro-2-[chloro-(3,4-dimethoxyphenyl)methyl]benzene (PubChem CID 63429005) has the molecular formula C15H13BrCl2O2 and a molecular weight of 376.08 g/mol. Its IUPAC name is 4-bromo-1-chloro-2-[chloro-(3,4-dimethoxyphenyl)methyl]benzene.
| Compound Name | 4-bromo-1-chloro-2-[chloro-(3,4-dimethoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 63429005 |
| Molecular Formula | C15H13BrCl2O2 |
| Molecular Weight | 376.08 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 4-bromo-1-chloro-2-[chloro-(3,4-dimethoxyphenyl)methyl]benzene |
| SMILES | COc1ccc(C(Cl)c2cc(Br)ccc2Cl)cc1OC |
| InChI | InChI=1S/C15H13BrCl2O2/c1-19-13-6-3-9(7-14(13)20-2)15(18)11-8-10(16)4-5-12(11)17/h3-8,15H,1-2H3 |
| InChIKey | PAEHYADQOLLPTQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.08 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|