C15H12ClF3O — CID 63429318
5-[chloro-(4-ethoxyphenyl)methyl]-1,2,3-trifluorobenzene (PubChem CID 63429318) has the molecular formula C15H12ClF3O and a molecular weight of 300.71 g/mol. Its IUPAC name is 5-[chloro-(4-ethoxyphenyl)methyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[chloro-(4-ethoxyphenyl)methyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 63429318 |
| Molecular Formula | C15H12ClF3O |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 5-[chloro-(4-ethoxyphenyl)methyl]-1,2,3-trifluorobenzene |
| SMILES | CCOc1ccc(C(Cl)c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H12ClF3O/c1-2-20-11-5-3-9(4-6-11)14(16)10-7-12(17)15(19)13(18)8-10/h3-8,14H,2H2,1H3 |
| InChIKey | CPNJPDFNPISJRD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|