C14H9Cl2F3 — CID 63430256
2-[1-chloro-2-(2-chlorophenyl)ethyl]-1,3,5-trifluorobenzene (PubChem CID 63430256) has the molecular formula C14H9Cl2F3 and a molecular weight of 305.13 g/mol. Its IUPAC name is 2-[1-chloro-2-(2-chlorophenyl)ethyl]-1,3,5-trifluorobenzene.
| Compound Name | 2-[1-chloro-2-(2-chlorophenyl)ethyl]-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 63430256 |
| Molecular Formula | C14H9Cl2F3 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 2-[1-chloro-2-(2-chlorophenyl)ethyl]-1,3,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(C(Cl)Cc2ccccc2Cl)c(F)c1 |
| InChI | InChI=1S/C14H9Cl2F3/c15-10-4-2-1-3-8(10)5-11(16)14-12(18)6-9(17)7-13(14)19/h1-4,6-7,11H,5H2 |
| InChIKey | GBFVBCYAKILIIX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|