C16H25Cl — CID 63430342
1-(1-chloro-2-methylbutyl)-2,3,4,5,6-pentamethylbenzene (PubChem CID 63430342) has the molecular formula C16H25Cl and a molecular weight of 252.83 g/mol. Its IUPAC name is 1-(1-chloro-2-methylbutyl)-2,3,4,5,6-pentamethylbenzene.
| Compound Name | 1-(1-chloro-2-methylbutyl)-2,3,4,5,6-pentamethylbenzene |
|---|---|
| PubChem CID | 63430342 |
| Molecular Formula | C16H25Cl |
| Molecular Weight | 252.83 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-(1-chloro-2-methylbutyl)-2,3,4,5,6-pentamethylbenzene |
| SMILES | CCC(C)C(Cl)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C16H25Cl/c1-8-9(2)16(17)15-13(6)11(4)10(3)12(5)14(15)7/h9,16H,8H2,1-7H3 |
| InChIKey | OHWGGAHHZXYFHT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.83 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|