C17H17Cl3 — CID 63430749
2,4-dichloro-1-[chloro-[4-(2-methylpropyl)phenyl]methyl]benzene (PubChem CID 63430749) has the molecular formula C17H17Cl3 and a molecular weight of 327.68 g/mol. Its IUPAC name is 2,4-dichloro-1-[chloro-[4-(2-methylpropyl)phenyl]methyl]benzene.
| Compound Name | 2,4-dichloro-1-[chloro-[4-(2-methylpropyl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 63430749 |
| Molecular Formula | C17H17Cl3 |
| Molecular Weight | 327.68 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2,4-dichloro-1-[chloro-[4-(2-methylpropyl)phenyl]methyl]benzene |
| SMILES | CC(C)Cc1ccc(C(Cl)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl3/c1-11(2)9-12-3-5-13(6-4-12)17(20)15-8-7-14(18)10-16(15)19/h3-8,10-11,17H,9H2,1-2H3 |
| InChIKey | KOWLHPYPTMAFFI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|