C16H15ClF2O — CID 63431622
4-[chloro-(3-propoxyphenyl)methyl]-1,2-difluorobenzene (PubChem CID 63431622) has the molecular formula C16H15ClF2O and a molecular weight of 296.74 g/mol. Its IUPAC name is 4-[chloro-(3-propoxyphenyl)methyl]-1,2-difluorobenzene.
| Compound Name | 4-[chloro-(3-propoxyphenyl)methyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 63431622 |
| Molecular Formula | C16H15ClF2O |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-[chloro-(3-propoxyphenyl)methyl]-1,2-difluorobenzene |
| SMILES | CCCOc1cccc(C(Cl)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C16H15ClF2O/c1-2-8-20-13-5-3-4-11(9-13)16(17)12-6-7-14(18)15(19)10-12/h3-7,9-10,16H,2,8H2,1H3 |
| InChIKey | FQPHJAKAMJLWEM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|