C16H19ClO — CID 63432646
3-[chloro-(4-propylphenyl)methyl]-2,5-dimethylfuran (PubChem CID 63432646) has the molecular formula C16H19ClO and a molecular weight of 262.78 g/mol. Its IUPAC name is 3-[chloro-(4-propylphenyl)methyl]-2,5-dimethylfuran.
| Compound Name | 3-[chloro-(4-propylphenyl)methyl]-2,5-dimethylfuran |
|---|---|
| PubChem CID | 63432646 |
| Molecular Formula | C16H19ClO |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-[chloro-(4-propylphenyl)methyl]-2,5-dimethylfuran |
| SMILES | CCCc1ccc(C(Cl)c2cc(C)oc2C)cc1 |
| InChI | InChI=1S/C16H19ClO/c1-4-5-13-6-8-14(9-7-13)16(17)15-10-11(2)18-12(15)3/h6-10,16H,4-5H2,1-3H3 |
| InChIKey | PWTIRDCHMGFQRD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|