C17H17Cl2F — CID 63433736
3-[chloro-(2-chloro-6-fluorophenyl)methyl]-1,2,4,5-tetramethylbenzene (PubChem CID 63433736) has the molecular formula C17H17Cl2F and a molecular weight of 311.23 g/mol. Its IUPAC name is 3-[chloro-(2-chloro-6-fluorophenyl)methyl]-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-[chloro-(2-chloro-6-fluorophenyl)methyl]-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 63433736 |
| Molecular Formula | C17H17Cl2F |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-[chloro-(2-chloro-6-fluorophenyl)methyl]-1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)c(C(Cl)c2c(F)cccc2Cl)c1C |
| InChI | InChI=1S/C17H17Cl2F/c1-9-8-10(2)12(4)15(11(9)3)17(19)16-13(18)6-5-7-14(16)20/h5-8,17H,1-4H3 |
| InChIKey | JJBKSVKCMZWSFC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|