C20H15N3OS2 — CID 6343459
N-[2-[(1Z,3E)-1-cyano-4-phenylbuta-1,3-dienyl]-4-thiophen-2-yl-1,3-thiazol-5-yl]acetamide (PubChem CID 6343459) has the molecular formula C20H15N3OS2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[2-[(1Z,3E)-1-cyano-4-phenylbuta-1,3-dienyl]-4-thiophen-2-yl-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-[2-[(1Z,3E)-1-cyano-4-phenylbuta-1,3-dienyl]-4-thiophen-2-yl-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 6343459 |
| Molecular Formula | C20H15N3OS2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-[2-[(1Z,3E)-1-cyano-4-phenylbuta-1,3-dienyl]-4-thiophen-2-yl-1,3-thiazol-5-yl]acetamide |
| SMILES | CC(=O)Nc1sc(/C(C#N)=C\C=C\c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C20H15N3OS2/c1-14(24)22-20-18(17-11-6-12-25-17)23-19(26-20)16(13-21)10-5-9-15-7-3-2-4-8-15/h2-12H,1H3,(H,22,24)/b9-5+,16-10- |
| InChIKey | KASZIOZYBJRRNL-RVXWWDRGSA-N |
| XLogP | 5.45 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|