C14H15BrS — CID 63435676
2-[bromo-(3,4-dimethylphenyl)methyl]-3-methylthiophene (PubChem CID 63435676) has the molecular formula C14H15BrS and a molecular weight of 295.25 g/mol. Its IUPAC name is 2-[bromo-(3,4-dimethylphenyl)methyl]-3-methylthiophene.
| Compound Name | 2-[bromo-(3,4-dimethylphenyl)methyl]-3-methylthiophene |
|---|---|
| PubChem CID | 63435676 |
| Molecular Formula | C14H15BrS |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-[bromo-(3,4-dimethylphenyl)methyl]-3-methylthiophene |
| SMILES | Cc1ccc(C(Br)c2sccc2C)cc1C |
| InChI | InChI=1S/C14H15BrS/c1-9-4-5-12(8-11(9)3)13(15)14-10(2)6-7-16-14/h4-8,13H,1-3H3 |
| InChIKey | GIIMEBMQVRVIPS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|