C16H14BrF3 — CID 63435678
4-[bromo-[3-(trifluoromethyl)phenyl]methyl]-1,2-dimethylbenzene (PubChem CID 63435678) has the molecular formula C16H14BrF3 and a molecular weight of 343.19 g/mol. Its IUPAC name is 4-[bromo-[3-(trifluoromethyl)phenyl]methyl]-1,2-dimethylbenzene.
| Compound Name | 4-[bromo-[3-(trifluoromethyl)phenyl]methyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 63435678 |
| Molecular Formula | C16H14BrF3 |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 4-[bromo-[3-(trifluoromethyl)phenyl]methyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C(Br)c2cccc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C16H14BrF3/c1-10-6-7-13(8-11(10)2)15(17)12-4-3-5-14(9-12)16(18,19)20/h3-9,15H,1-2H3 |
| InChIKey | RQKJUOJDYUMFMA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|