C18H29NS — CID 63436798
N-[1-(4-methylsulfanylphenyl)ethyl]-4-propan-2-ylcyclohexan-1-amine (PubChem CID 63436798) has the molecular formula C18H29NS and a molecular weight of 291.50 g/mol. Its IUPAC name is N-[1-(4-methylsulfanylphenyl)ethyl]-4-propan-2-ylcyclohexan-1-amine.
| Compound Name | N-[1-(4-methylsulfanylphenyl)ethyl]-4-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63436798 |
| Molecular Formula | C18H29NS |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-[1-(4-methylsulfanylphenyl)ethyl]-4-propan-2-ylcyclohexan-1-amine |
| SMILES | CSc1ccc(C(C)NC2CCC(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H29NS/c1-13(2)15-5-9-17(10-6-15)19-14(3)16-7-11-18(20-4)12-8-16/h7-8,11-15,17,19H,5-6,9-10H2,1-4H3 |
| InChIKey | AGDITNUWYPOFCL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |