C17H16Br2O2 — CID 63437497
7-[bromo-(4-bromo-2-methylphenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 63437497) has the molecular formula C17H16Br2O2 and a molecular weight of 412.12 g/mol. Its IUPAC name is 7-[bromo-(4-bromo-2-methylphenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-[bromo-(4-bromo-2-methylphenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 63437497 |
| Molecular Formula | C17H16Br2O2 |
| Molecular Weight | 412.12 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | 7-[bromo-(4-bromo-2-methylphenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | Cc1cc(Br)ccc1C(Br)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C17H16Br2O2/c1-11-9-13(18)4-5-14(11)17(19)12-3-6-15-16(10-12)21-8-2-7-20-15/h3-6,9-10,17H,2,7-8H2,1H3 |
| InChIKey | RWJLPAZMYUEENQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.12 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|