C18H23BrS — CID 63438170
2-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]-5-ethylthiophene (PubChem CID 63438170) has the molecular formula C18H23BrS and a molecular weight of 351.35 g/mol. Its IUPAC name is 2-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]-5-ethylthiophene.
| Compound Name | 2-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]-5-ethylthiophene |
|---|---|
| PubChem CID | 63438170 |
| Molecular Formula | C18H23BrS |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]-5-ethylthiophene |
| SMILES | CCc1ccc(C(Br)c2c(C)c(C)c(C)c(C)c2C)s1 |
| InChI | InChI=1S/C18H23BrS/c1-7-15-8-9-16(20-15)18(19)17-13(5)11(3)10(2)12(4)14(17)6/h8-9,18H,7H2,1-6H3 |
| InChIKey | XNPGXGPLMGCHHH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|