C15H13Br2F — CID 63438862
1-[bromo-(2-bromo-4-fluorophenyl)methyl]-2,4-dimethylbenzene (PubChem CID 63438862) has the molecular formula C15H13Br2F and a molecular weight of 372.08 g/mol. Its IUPAC name is 1-[bromo-(2-bromo-4-fluorophenyl)methyl]-2,4-dimethylbenzene.
| Compound Name | 1-[bromo-(2-bromo-4-fluorophenyl)methyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 63438862 |
| Molecular Formula | C15H13Br2F |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | 1-[bromo-(2-bromo-4-fluorophenyl)methyl]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C(Br)c2ccc(F)cc2Br)c(C)c1 |
| InChI | InChI=1S/C15H13Br2F/c1-9-3-5-12(10(2)7-9)15(17)13-6-4-11(18)8-14(13)16/h3-8,15H,1-2H3 |
| InChIKey | WTQONHXCPYIBML-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|