C13Cl4F8 — CID 634395
1-chloro-4-[dichloro-(4-chloro-2,3,5,6-tetrafluorophenyl)methyl]-2,3,5,6-tetrafluorobenzene (PubChem CID 634395) has the molecular formula C13Cl4F8 and a molecular weight of 449.94 g/mol. Its IUPAC name is 1-chloro-4-[dichloro-(4-chloro-2,3,5,6-tetrafluorophenyl)methyl]-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-chloro-4-[dichloro-(4-chloro-2,3,5,6-tetrafluorophenyl)methyl]-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 634395 |
| Molecular Formula | C13Cl4F8 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 447.86 |
| IUPAC Name | 1-chloro-4-[dichloro-(4-chloro-2,3,5,6-tetrafluorophenyl)methyl]-2,3,5,6-tetrafluorobenzene |
| SMILES | Fc1c(F)c(C(Cl)(Cl)c2c(F)c(F)c(Cl)c(F)c2F)c(F)c(F)c1Cl |
| InChI | InChI=1S/C13Cl4F8/c14-3-9(22)5(18)1(6(19)10(3)23)13(16,17)2-7(20)11(24)4(15)12(25)8(2)21 |
| InChIKey | BEHQVGGINBEKFQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|