C28H36N4 — CID 634396
5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 634396) has the molecular formula C28H36N4 and a molecular weight of 428.62 g/mol. Its IUPAC name is 5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 634396 |
| Molecular Formula | C28H36N4 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CC1(C)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(C)c2ccc1[nH]2 |
| InChI | InChI=1S/C28H36N4/c1-25(2)17-9-11-19(29-17)26(3,4)21-13-15-23(31-21)28(7,8)24-16-14-22(32-24)27(5,6)20-12-10-18(25)30-20/h9-16,29-32H,1-8H3 |
| InChIKey | XZCHDFOYWDLFEY-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |