About 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene
5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene (PubChem CID 63440354) has the molecular formula C17H17Br
and a molecular weight of 301.23 g/mol. Its IUPAC name is 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene |
| PubChem CID | 63440354 |
| Molecular Formula | C17H17Br |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene |
| SMILES | BrC(Cc1ccccc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H17Br/c18-17(11-13-5-2-1-3-6-13)16-10-9-14-7-4-8-15(14)12-16/h1-3,5-6,9-10,12,17H,4,7-8,11H2 |
| InChIKey | JVBPYYUYQXIOCG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene?
The IUPAC name of 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene (CID 63440354) is 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene.
What is the SMILES notation for 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene?
The canonical SMILES for 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene is BrC(Cc1ccccc1)c1ccc2c(c1)CCC2.
What is the InChIKey of 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene?
The InChIKey is JVBPYYUYQXIOCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Br/c18-17(11-13-5-2-1-3-6-13)16-10-9-14-7-4-8-15(14)12-16/h1-3,5-6,9-10,12,17H,4,7-8,11H2.
What are the key properties of 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene?
5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene has a molecular weight of 301.23 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-bromo-2-phenylethyl)-2,3-dihydro-1H-indene is sourced from PubChem (CID 63440354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).