About 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene
3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene (PubChem CID 63440372) has the molecular formula C17H23BrS
and a molecular weight of 339.34 g/mol. Its IUPAC name is 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene.
Molecular Properties
| Compound Name | 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene |
| PubChem CID | 63440372 |
| Molecular Formula | C17H23BrS |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene |
| SMILES | Cc1cc(C(Br)C23CC4CC(CC(C4)C2)C3)c(C)s1 |
| InChI | InChI=1S/C17H23BrS/c1-10-3-15(11(2)19-10)16(18)17-7-12-4-13(8-17)6-14(5-12)9-17/h3,12-14,16H,4-9H2,1-2H3 |
| InChIKey | RMISWPPXXZCFTR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene?
The IUPAC name of 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene (CID 63440372) is 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene.
What is the SMILES notation for 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene?
The canonical SMILES for 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene is Cc1cc(C(Br)C23CC4CC(CC(C4)C2)C3)c(C)s1.
What is the InChIKey of 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene?
The InChIKey is RMISWPPXXZCFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23BrS/c1-10-3-15(11(2)19-10)16(18)17-7-12-4-13(8-17)6-14(5-12)9-17/h3,12-14,16H,4-9H2,1-2H3.
What are the key properties of 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene?
3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene has a molecular weight of 339.34 g/mol, XLogP of 6.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-adamantyl(bromo)methyl]-2,5-dimethylthiophene is sourced from PubChem (CID 63440372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).