C22H21FN4O4S — CID 6344154
[(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-4-(1,3-benzodioxol-5-yl)butan-2-ylideneamino]carbamimidothioate (PubChem CID 6344154) has the molecular formula C22H21FN4O4S and a molecular weight of 456.50 g/mol. Its IUPAC name is [(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-4-(1,3-benzodioxol-5-yl)butan-2-ylideneamino]carbamimidothioate.
| Compound Name | [(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-4-(1,3-benzodioxol-5-yl)butan-2-ylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 6344154 |
| Molecular Formula | C22H21FN4O4S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-4-(1,3-benzodioxol-5-yl)butan-2-ylideneamino]carbamimidothioate |
| SMILES | C/C(CCc1ccc2c(c1)OCO2)=N/N=C(/N)S[C@H]1CC(=O)N(c2ccccc2F)C1=O |
| InChI | InChI=1S/C22H21FN4O4S/c1-13(6-7-14-8-9-17-18(10-14)31-12-30-17)25-26-22(24)32-19-11-20(28)27(21(19)29)16-5-3-2-4-15(16)23/h2-5,8-10,19H,6-7,11-12H2,1H3,(H2,24,26)/b25-13-/t19-/m0/s1 |
| InChIKey | ZANJFXCNXVPZKX-YCCHBACSSA-N |
| XLogP | 3.24 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|