C17H16BrFO — CID 63441578
5-[bromo-(5-fluoro-2-methoxyphenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 63441578) has the molecular formula C17H16BrFO and a molecular weight of 335.22 g/mol. Its IUPAC name is 5-[bromo-(5-fluoro-2-methoxyphenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[bromo-(5-fluoro-2-methoxyphenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 63441578 |
| Molecular Formula | C17H16BrFO |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 5-[bromo-(5-fluoro-2-methoxyphenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | COc1ccc(F)cc1C(Br)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H16BrFO/c1-20-16-8-7-14(19)10-15(16)17(18)13-6-5-11-3-2-4-12(11)9-13/h5-10,17H,2-4H2,1H3 |
| InChIKey | WACTXQJKIZBYDB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|