C13H17BrO — CID 63443124
5-(1-bromobutyl)-2-methyl-2,3-dihydro-1-benzofuran (PubChem CID 63443124) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is 5-(1-bromobutyl)-2-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-(1-bromobutyl)-2-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 63443124 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5-(1-bromobutyl)-2-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CCCC(Br)c1ccc2c(c1)CC(C)O2 |
| InChI | InChI=1S/C13H17BrO/c1-3-4-12(14)10-5-6-13-11(8-10)7-9(2)15-13/h5-6,8-9,12H,3-4,7H2,1-2H3 |
| InChIKey | RMZXZXVVLNNQRU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|