C14H8Cl3F3 — CID 63443981
2,4-dichloro-1-[chloro-[2-(trifluoromethyl)phenyl]methyl]benzene (PubChem CID 63443981) has the molecular formula C14H8Cl3F3 and a molecular weight of 339.57 g/mol. Its IUPAC name is 2,4-dichloro-1-[chloro-[2-(trifluoromethyl)phenyl]methyl]benzene.
| Compound Name | 2,4-dichloro-1-[chloro-[2-(trifluoromethyl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 63443981 |
| Molecular Formula | C14H8Cl3F3 |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 2,4-dichloro-1-[chloro-[2-(trifluoromethyl)phenyl]methyl]benzene |
| SMILES | FC(F)(F)c1ccccc1C(Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl3F3/c15-8-5-6-10(12(16)7-8)13(17)9-3-1-2-4-11(9)14(18,19)20/h1-7,13H |
| InChIKey | ABKWPOCGQUEZOG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|