About 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline
1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline (PubChem CID 63445814) has the molecular formula C18H21ClN2
and a molecular weight of 300.83 g/mol. Its IUPAC name is 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 63445814 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline |
| SMILES | Cc1ccc2c(c1)CCCN2c1nc(C)cc(C)c1CCl |
| InChI | InChI=1S/C18H21ClN2/c1-12-6-7-17-15(9-12)5-4-8-21(17)18-16(11-19)13(2)10-14(3)20-18/h6-7,9-10H,4-5,8,11H2,1-3H3 |
| InChIKey | VOEJAQZOIUPIKU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline?
The IUPAC name of 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline (CID 63445814) is 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline is Cc1ccc2c(c1)CCCN2c1nc(C)cc(C)c1CCl.
What is the InChIKey of 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline?
The InChIKey is VOEJAQZOIUPIKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN2/c1-12-6-7-17-15(9-12)5-4-8-21(17)18-16(11-19)13(2)10-14(3)20-18/h6-7,9-10H,4-5,8,11H2,1-3H3.
What are the key properties of 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline?
1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline has a molecular weight of 300.83 g/mol, XLogP of 4.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-6-methyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 63445814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).