C15H12BrClN2OS — CID 63447673
5-bromo-6-[chloro(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 63447673) has the molecular formula C15H12BrClN2OS and a molecular weight of 383.70 g/mol. Its IUPAC name is 5-bromo-6-[chloro(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-bromo-6-[chloro(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 63447673 |
| Molecular Formula | C15H12BrClN2OS |
| Molecular Weight | 383.70 g/mol |
| Exact Mass | 381.95 |
| IUPAC Name | 5-bromo-6-[chloro(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(Br)c(C(Cl)c3cc4c(s3)CCC4)cc2[nH]1 |
| InChI | InChI=1S/C15H12BrClN2OS/c16-9-6-11-10(18-15(20)19-11)5-8(9)14(17)13-4-7-2-1-3-12(7)21-13/h4-6,14H,1-3H2,(H2,18,19,20) |
| InChIKey | LEXUZWUCJITWNP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|