C17H20BrNO — CID 63449025
4-[(4-bromo-2,6-dimethylanilino)methyl]-2,6-dimethylphenol (PubChem CID 63449025) has the molecular formula C17H20BrNO and a molecular weight of 334.26 g/mol. Its IUPAC name is 4-[(4-bromo-2,6-dimethylanilino)methyl]-2,6-dimethylphenol.
| Compound Name | 4-[(4-bromo-2,6-dimethylanilino)methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 63449025 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 4-[(4-bromo-2,6-dimethylanilino)methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(CNc2c(C)cc(Br)cc2C)cc(C)c1O |
| InChI | InChI=1S/C17H20BrNO/c1-10-7-15(18)8-11(2)16(10)19-9-14-5-12(3)17(20)13(4)6-14/h5-8,19-20H,9H2,1-4H3 |
| InChIKey | ABEOSBDAQJIIIY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |