About 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline
4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline (PubChem CID 63449070) has the molecular formula C15H20BrN
and a molecular weight of 294.24 g/mol. Its IUPAC name is 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline |
| PubChem CID | 63449070 |
| Molecular Formula | C15H20BrN |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline |
| SMILES | Cc1cc(Br)cc(C)c1NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C15H20BrN/c1-9-7-13(16)8-10(2)14(9)17-15(11-3-4-11)12-5-6-12/h7-8,11-12,15,17H,3-6H2,1-2H3 |
| InChIKey | POCGRQVNSZZJCB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline?
The IUPAC name of 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline (CID 63449070) is 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline.
What is the SMILES notation for 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline?
The canonical SMILES for 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline is Cc1cc(Br)cc(C)c1NC(C1CC1)C1CC1.
What is the InChIKey of 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline?
The InChIKey is POCGRQVNSZZJCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrN/c1-9-7-13(16)8-10(2)14(9)17-15(11-3-4-11)12-5-6-12/h7-8,11-12,15,17H,3-6H2,1-2H3.
What are the key properties of 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline?
4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline has a molecular weight of 294.24 g/mol, XLogP of 4.67, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(dicyclopropylmethyl)-2,6-dimethylaniline is sourced from PubChem (CID 63449070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).