C18H21NO2 — CID 63450626
(2,4,6-trimethylphenyl)methyl 3-amino-4-methylbenzoate (PubChem CID 63450626) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)methyl 3-amino-4-methylbenzoate.
| Compound Name | (2,4,6-trimethylphenyl)methyl 3-amino-4-methylbenzoate |
|---|---|
| PubChem CID | 63450626 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2,4,6-trimethylphenyl)methyl 3-amino-4-methylbenzoate |
| SMILES | Cc1cc(C)c(COC(=O)c2ccc(C)c(N)c2)c(C)c1 |
| InChI | InChI=1S/C18H21NO2/c1-11-7-13(3)16(14(4)8-11)10-21-18(20)15-6-5-12(2)17(19)9-15/h5-9H,10,19H2,1-4H3 |
| InChIKey | AKBQOGIBLRIJHC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|